CAS 98827-44-2
:2H-Thieno[2,3-e]-1,2-thiazine-3-carboxylic acid, 4-hydroxy-, methyl ester, 1,1-dioxide
Description:
2H-Thieno[2,3-e]-1,2-thiazine-3-carboxylic acid, 4-hydroxy-, methyl ester, 1,1-dioxide, commonly referred to by its CAS number 98827-44-2, is a heterocyclic compound featuring a thieno-thiazine structure. This compound is characterized by the presence of a thieno ring fused to a thiazine ring, which contributes to its unique chemical properties. The carboxylic acid group and the methyl ester functional group indicate that it can participate in various chemical reactions, such as esterification and hydrolysis. The 4-hydroxy substitution suggests potential for hydrogen bonding and increased solubility in polar solvents. Additionally, the 1,1-dioxide functionality implies the presence of sulfone-like characteristics, which can influence its reactivity and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Overall, the compound's unique heterocyclic framework and functional groups contribute to its diverse chemical behavior and potential utility in various fields.
Formula:C8H7NO5S2
InChI:InChI=1S/C8H7NO5S2/c1-14-8(11)5-6(10)7-4(2-3-15-7)16(12,13)9-5/h2-3,9-10H,1H3
InChI key:InChIKey=QHDGDSKIUCBIGS-UHFFFAOYSA-N
SMILES:O=S1(=O)C2=C(C(O)=C(C(OC)=O)N1)SC=C2
Synonyms:- 2H-thieno[2,3-e]-1,2-thiazine-3-carboxylic acid, 4-hydroxy-, methyl ester, 1,1-dioxide
- methy1 4-hydroxy-2H-thieno[2,3-e]-1,2-thiazine-3-carboxylate-1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Methyl 4-hydroxy-2H-thieno[2,3-e][1,2]thiazine-3-carboxylate 1,1-dioxide
CAS:Formula:C8H7NO5S2Molecular weight:261.2749


