CymitQuimica logo

CAS 98841-72-6

:

1,2,3,4-Tetrahydro-1-naphthalenecarboxamide

Description:
1,2,3,4-Tetrahydro-1-naphthalenecarboxamide is an organic compound characterized by its bicyclic structure, which consists of a naphthalene ring system that has been partially saturated. This compound features a carboxamide functional group, which contributes to its chemical reactivity and solubility properties. It is typically a solid at room temperature and may exhibit moderate polarity due to the presence of the amide group. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a scaffold for drug development. Its structural characteristics can influence its biological activity, making it a subject of study for potential therapeutic applications. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, 1,2,3,4-Tetrahydro-1-naphthalenecarboxamide represents a unique chemical entity with potential applications in research and industry.
Formula:C11H13NO
InChI:InChI=1S/C11H13NO/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2,(H2,12,13)
InChI key:InChIKey=YABTYLPBLUXORV-UHFFFAOYSA-N
SMILES:C(N)(=O)C1C=2C(CCC1)=CC=CC2
Synonyms:
  • 1-Naphthalenecarboxamide, 1,2,3,4-tetrahydro-
  • 1,2,3,4-Tetrahydro-1-naphthalenecarboxamide
  • 1-Naphthamide, 1,2,3,4-tetrahydro-
  • 1,2,3,4-Tetrahydro-[1]naphthamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.