CAS 98891-44-2
:Pseudolaric acid A O-β-D-glucopyranoside
Description:
Pseudolaric acid A O-β-D-glucopyranoside is a glycoside derived from pseudolaric acid A, which is a natural compound found in the bark of the Pseudolarix amabilis tree. This substance is characterized by its structural composition, which includes a pseudolaric acid moiety linked to a β-D-glucopyranoside unit. It exhibits various biological activities, including potential anti-inflammatory and anti-tumor properties, making it of interest in pharmacological research. The compound is typically studied for its effects on cellular processes and its potential therapeutic applications. In terms of solubility, glycosides like this one are often more soluble in water compared to their aglycone counterparts due to the presence of the hydrophilic sugar moiety. The compound's molecular interactions and stability can be influenced by factors such as pH and temperature. Overall, Pseudolaric acid A O-β-D-glucopyranoside represents a fascinating area of study within natural product chemistry and pharmacognosy.
Formula:C28H38O11
InChI:InChI=1S/C28H38O11/c1-15-7-11-27-12-9-19(28(27,13-8-15)38-17(3)30)26(4,39-25(27)35)10-5-6-16(2)23(34)37-24-22(33)21(32)20(31)18(14-29)36-24/h5-7,10,18-22,24,29,31-33H,8-9,11-14H2,1-4H3/b10-5+,16-6+/t18-,19+,20-,21+,22-,24+,26-,27-,28+/m1/s1
InChI key:InChIKey=IVYWRYGMQNKDQB-VHJBJYHKSA-N
SMILES:O(C(C)=O)[C@]12[C@@]3(CC[C@]1([C@](/C=C/C=C(/C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=O)\C)(C)OC3=O)[H])CC=C(C)CC2
Synonyms:- 1H-4,9a-Ethanocyclohepta[c]pyran, 2,4-pentadienoic acid deriv.
- Pseudolaric acid A O-β-D-glucopyranoside
- Pseudolaric acid A β-D-glucoside
- β-D-Glucopyranose, 1-[(2E,4E)-5-[(3R,4S,4aS,9aR)-4a-(acetyloxy)-3,4,4a,5,6,9-hexahydro-3,7-dimethyl-1-oxo-1H-4,9a-ethanocyclohepta[c]pyran-3-yl]-2-methyl-2,4-pentadienoate]
- Pseudolaric acid A-glucopyranoside
- Pseudolaricid A-O-β-D-glucopyranoside
- PubChem ID: 44566375
- Pseudolaric acid A beta-D-glucoside
- Pseudolaric Acid A-O-beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pseudolaric acid A-O-β-D-glucopyranoside
CAS:Pseudolaric acid A-O-β-D-glucopyranosidePurity:≥98%Molecular weight:550.6g/molPseudolaric acid A-O-β-D-glucopyranoside
CAS:Pseudolaric acid A-O-β-D-glucopyranoside (Pseudolaric acid A-O-beta-D-glucopyranoside) is a natural product with antibacterial, anticancerFormula:C28H38O11Purity:99.5% - 99.7%Color and Shape:SolidMolecular weight:550.60Pseudolaric acid a-glucopyranoside
CAS:Natural glycosideFormula:C28H38O11Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:550.6Pseudolaric acid A beta-D-glucoside
CAS:Pseudolaric acid A beta-D-glucoside is a bioactive compound, which is a natural product derived from Pseudolarix amabilis, a species of tree native to certain regions of China. It belongs to the diterpenoid family, known for their diverse structural features and significant biological activities. This compound exhibits its mode of action primarily through interactions with cellular pathways, modulating specific enzymatic activities and receptor responses, which can lead to varying effects at the cellular and molecular levels.
Purity:Min. 95%




