CAS 98897-14-4
:N-(hydroxymethyl)adenosine
Description:
N-(hydroxymethyl)adenosine is a modified nucleoside that features an adenosine backbone with a hydroxymethyl group attached to the nitrogen atom at the 6-position. This structural modification can influence its biochemical properties and interactions. The compound is known to play a role in various biological processes, particularly in the context of cellular signaling and metabolism. It may exhibit unique pharmacological properties, making it of interest in research related to nucleoside analogs and their potential therapeutic applications. The presence of the hydroxymethyl group can enhance solubility and stability compared to unmodified nucleosides. Additionally, N-(hydroxymethyl)adenosine can participate in hydrogen bonding and other interactions that may affect its binding affinity to enzymes or receptors. Its CAS number, 98897-14-4, is a unique identifier that facilitates the cataloging and retrieval of information regarding this compound in chemical databases. Overall, N-(hydroxymethyl)adenosine represents a significant area of study in medicinal chemistry and biochemistry due to its potential implications in drug development and cellular function.
Formula:C11H15N5O5
InChI:InChI=1/C11H15N5O5/c17-1-5-7(19)8(20)11(21-5)16-3-14-6-9(15-4-18)12-2-13-10(6)16/h2-3,5,7-8,11,17-20H,1,4H2,(H,12,13,15)/t5-,7-,8-,11-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(ncnc23)NCO)O1)O)O)O
Synonyms:- adenosine, N-(hydroxymethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N6-(Hydroxymethyl)adenosine (~90%)
CAS:<p>Applications N6-(Hydroxymethyl)adenosine is an intermediate with modified ribonucleoside formed by chemical oxidation of N6-methyladenosine (M275895) mediated by bicarbonate-activated hydrogen peroxide. N6-(Hydroxymethyl)adenosine is also reported as active mutagen.<br>References Alderson, T.: Mutat. Res-Rev. Genet., 154, 101 (1985); Wu, J., et al.: Chem. Sci., 6, 3013 (2015);<br></p>Formula:C11H15N5O5Purity:~90%Color and Shape:NeatMolecular weight:297.27N6-Hydroxymethyladenosine
CAS:<p>Please enquire for more information about N6-Hydroxymethyladenosine including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C11H15N5O5Purity:Min. 95%Color and Shape:PowderMolecular weight:297.27 g/mol

