CAS 98919-14-3
:1,3-Dioxolane, 2-[(3,4-dichlorophenoxy)methyl]-
Description:
1,3-Dioxolane, 2-[(3,4-dichlorophenoxy)methyl]- is a chemical compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms and three carbon atoms. This compound features a phenoxy group substituted with two chlorine atoms at the 3 and 4 positions of the aromatic ring, contributing to its unique chemical properties. The presence of the dioxolane moiety suggests potential applications in organic synthesis and as a solvent due to its relatively low polarity and ability to stabilize reactive intermediates. The dichlorophenoxy group may enhance the compound's biological activity, making it of interest in agrochemical or pharmaceutical research. Additionally, the compound's molecular structure indicates potential for interactions with various biological targets, which could be explored in drug development or environmental studies. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental impact. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to basic organic frameworks.
Formula:C10H10Cl2O3
InChI:InChI=1S/C10H10Cl2O3/c11-8-2-1-7(5-9(8)12)15-6-10-13-3-4-14-10/h1-2,5,10H,3-4,6H2
InChI key:InChIKey=MOIVQWRKOMUHGZ-UHFFFAOYSA-N
SMILES:O(CC1OCCO1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 2-(3,4-Dichlorophenoxymethyl)-1,3-dioxolane
- 1,3-Dioxolane, 2-[(3,4-dichlorophenoxy)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.