
CAS 98952-72-8
:5-Ethyl-2-methyl-4-pyridinecarbonitrile
Description:
5-Ethyl-2-methyl-4-pyridinecarbonitrile, with the CAS number 98952-72-8, is a heterocyclic organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl group and a methyl group attached to the pyridine ring, contributing to its unique chemical properties. The presence of the cyano group (–C≡N) at the 4-position of the pyridine ring enhances its reactivity, making it useful in various synthetic applications. Typically, compounds like this exhibit polar characteristics due to the electronegative nitrogen and cyano groups, which can influence their solubility in polar solvents. Additionally, the presence of multiple substituents can affect the compound's boiling and melting points, as well as its overall stability. 5-Ethyl-2-methyl-4-pyridinecarbonitrile may find applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, owing to its functional groups that can participate in further chemical reactions.
Formula:C9H10N2
InChI:InChI=1S/C9H10N2/c1-3-8-6-11-7(2)4-9(8)5-10/h4,6H,3H2,1-2H3
InChI key:InChIKey=LLQJPGWFCMFCFT-UHFFFAOYSA-N
SMILES:C(C)C=1C(C#N)=CC(C)=NC1
Synonyms:- 4-Pyridinecarbonitrile, 5-ethyl-2-methyl-
- 5-Ethyl-2-methyl-4-pyridinecarbonitrile
- Isonicotinonitrile, 5-ethyl-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
