CymitQuimica logo

CAS 98960-08-8

:

3-methoxy-4-(methoxymethoxy)aniline

Description:
3-Methoxy-4-(methoxymethoxy)aniline, with the CAS number 98960-08-8, is an organic compound that belongs to the class of anilines, which are aromatic amines characterized by the presence of an amino group attached to a benzene ring. This particular compound features two methoxy groups (-OCH3) that enhance its solubility and reactivity. The presence of these methoxy substituents can influence the compound's electronic properties, making it potentially useful in various chemical applications, including as a building block in organic synthesis or in the development of pharmaceuticals. The compound is likely to exhibit moderate polarity due to the methoxy groups, which can participate in hydrogen bonding. Additionally, its structure suggests that it may have applications in dye chemistry or as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H13NO3
InChI:InChI=1/C9H13NO3/c1-11-6-13-8-4-3-7(10)5-9(8)12-2/h3-5H,6,10H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.