CAS 98982-99-1

N-[2-(dimethylnitroryl)ethyl]-N-(4-methoxybenzyl)pyridin-2-amine

Description:

N-[2-(dimethylnitroyl)ethyl]-N-(4-methoxybenzyl)pyridin-2-amine, with the CAS number 98982-99-1, is a chemical compound that features a pyridine ring substituted with an amine group and various alkyl and aromatic groups. This compound is characterized by its complex structure, which includes a dimethylnitroyl group that contributes to its potential reactivity and biological activity. The presence of the methoxybenzyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The nitro group can also impart unique electronic properties, making it of interest in medicinal chemistry and drug design. Additionally, the compound may exhibit specific pharmacological activities, which could be explored in various therapeutic contexts. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, reactivity, and potential applications would be subjects of further investigation in both academic and industrial research settings.

Formula: C₁₇H₂₃N₃O₂

InChI: InChI=1/C17H23N3O2/c1-20(2,21)13-12-19(17-6-4-5-11-18-17)14-15-7-9-16(22-3)10-8-15/h4-11H,12-14H2,1-3H3

SMILES: CN(=O)(C)CCN(Cc1ccc(cc1)OC)c1ccccn1

Mepyramine N-Oxide

CAS: 98982-99-1

Formula: C₁₇H₂₃N₃O₂

Molecular weight: 301.39

Ref: ST-EA-CP-M63005

Mepyramine N-Oxide

CAS: 98982-99-1

Formula: C₁₇H₂₃N₃O₂

Color and Shape: Pale Yellow Solid

Molecular weight: 301.39

Ref: 4Z-M-179002

Mepyramine N-Oxide

Controlled Product

CAS: 98982-99-1

Formula: C₁₇H₂₃N₃O₂

Color and Shape: Neat

Molecular weight: 301.383

Ref: TR-M329486