CAS 98995-06-3

4-amino-2-chloro-N,N-dimethylbenzamide

Description:

4-Amino-2-chloro-N,N-dimethylbenzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. The presence of the amino group (-NH2) and the dimethyl groups attached to the nitrogen atom contribute to its basicity and solubility in polar solvents. The chlorine atom at the 2-position of the benzene ring introduces a halogen substituent, which can influence the compound's reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. It is important in various chemical applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. The molecular structure allows for various interactions, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₁ClN₂O

InChI: InChI=1/C9H11ClN2O/c1-12(2)9(13)7-4-3-6(11)5-8(7)10/h3-5H,11H2,1-2H3

SMILES: CN(C)C(=O)c1ccc(cc1Cl)N

Synonyms:

• benzamide, 4-amino-2-chloro-N,N-dimethyl-

4-Amino-2-chloro-N,N-dimethylbenzamide

CAS: 98995-06-3

Formula: C₉H₁₁ClN₂O

Color and Shape: Solid

Molecular weight: 198.6494

Ref: IN-DA0066J4

4-Amino-2-chloro-N,N-dimethylbenzamide

CAS: 98995-06-3

4-Amino-2-chloro-N,N-dimethylbenzamide

Purity: 98%

Molecular weight: 198.65g/mol

Ref: 54-OR911255

4-Amino-2-chloro-N,N-dimethylbenzamide

CAS: 98995-06-3

Versatile small molecule scaffold

Formula: C₉H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 198.65 g/mol

Ref: 3D-YDA99506