CAS 99-05-8

3-Aminobenzoic acid

Description:

3-Aminobenzoic acid, also known as meta-aminobenzoic acid, is an aromatic amine and a derivative of benzoic acid. It features an amino group (-NH2) attached to the meta position of the benzene ring relative to the carboxylic acid group (-COOH). This compound is a white crystalline solid that is soluble in water and organic solvents, such as ethanol and acetone. It has a melting point that typically falls within a specific range, indicating its solid state at room temperature. 3-Aminobenzoic acid is known for its role in various applications, including as a precursor in the synthesis of dyes, pharmaceuticals, and as a UV filter in sunscreens. Additionally, it can act as a pH indicator and is utilized in biochemical research. The compound exhibits both acidic and basic properties due to the presence of the carboxylic acid and amino groups, respectively, allowing it to participate in various chemical reactions. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes.

Formula:C₇H₇NO₂

InChI:InChI=1/C7H7NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H,9,10)/p-1

InChI key:InChIKey=XFDUHJPVQKIXHO-UHFFFAOYSA-N

SMILES:C(O)(=O)C1=CC(N)=CC=C1

Synonyms: