CAS 99-11-6
:Citrazinic acid
Description:
Citrazinic acid, with the CAS number 99-11-6, is an organic compound that belongs to the class of amino acids and is a derivative of citric acid. It is characterized by its structure, which includes a carboxylic acid group and an amino group, making it a zwitterionic compound at physiological pH. Citrazinic acid is typically a white crystalline solid that is soluble in water, reflecting its polar nature. It exhibits properties such as being a weak acid due to the presence of the carboxylic group, and it can participate in various chemical reactions, including esterification and amidation. This compound is of interest in biochemical research and may have applications in pharmaceuticals and food chemistry, particularly as a potential flavoring agent or preservative. Additionally, its role in metabolic pathways and interactions with other biomolecules can be significant in biological systems. Overall, citrazinic acid is a versatile compound with various implications in both scientific research and practical applications.
Formula:C6H5NO4
InChI:InChI=1S/C6H5NO4/c8-4-1-3(6(10)11)2-5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9)
InChI key:InChIKey=CSGQJHQYWJLPKY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=O)NC(O)=C1
Synonyms:- 1,2-Dihydro-6-hydroxy-2-oxo-4-pyridinecarboxylic acid
- 2,6-Dihydroxy-4-carboxypyridine
- 2,6-Dihydroxy-4-pyridincarbonsaeure
- 2,6-Dihydroxy-4-pyridinecarboxylic acid
- 2,6-Dihydroxyisonicotinic acid
- 2,6-Dihydroxypyridine-4-carboxylic acid
- 2-Hydroxy-6-oxo-1H-pyridine-4-carboxylic acid
- 3,5-Dihydroxypyridine-4-Carboxylic Acid
- 4-Pyridinecarboxylic acid, 1,2-dihydro-6-hydroxy-2-oxo-
- 6-Hydroxy-2-Oxo-1,2-Dihydropyridine-4-Carboxylate
- 6-Hydroxy-2-Oxo-1,2-Dihydropyridine-4-Carboxylic Acid
- 6-Hydroxy-4-carboxy-2-pyridone
- Cga 129218
- Isonicotinic acid, 1,2-dihydro-6-hydroxy-2-oxo-
- Isonicotinic acid, 2,6-dihydroxy-
- NSC 41334
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Pyridinecarboxylic acid, 1,2-dihydro-6-hydroxy-2-oxo-
CAS:Formula:C6H5NO4Purity:98%Color and Shape:SolidMolecular weight:155.1082Citrazinic acid
CAS:Formula:C6H5NO4Purity:≥ 98.0%Color and Shape:Yellow to orange, tan or green powder or crystalsMolecular weight:155.11Citrazinic acid
CAS:Citrazinic acid blocks TB enzyme and helps create pyrimidinone and oxazinone derivatives.Formula:C6H5NO4Purity:98%Color and Shape:Beige Slightly Brown PowderMolecular weight:155.11Citrazinic Acid
CAS:Formula:C6H5NO4Purity:>96.0%(T)Color and Shape:White to Amber to Dark green powder to crystalMolecular weight:155.112,6-Dihydroxyisonicotinic acid
CAS:2,6-Dihydroxyisonicotinic acidFormula:C6H5NO4Purity:98%Color and Shape: brown solidMolecular weight:155.11g/molCitrazinic Acid extrapure, 97%
CAS:Formula:C6H5NO4Purity:min. 97.0%Color and Shape:Yellow to orange to tan, Powder or crystalsMolecular weight:155.116-Hydroxy-2-oxo-1,2-dihydro-pyridine-4-carboxylic acid
CAS:Formula:C6H5NO4Purity:98%Color and Shape:SolidMolecular weight:155.109







