CAS 99007-90-6

2-[(4-oxo-3-phenyl-4H-chromen-7-yl)oxy]propanoic acid

Description:

2-[(4-oxo-3-phenyl-4H-chromen-7-yl)oxy]propanoic acid, with the CAS number 99007-90-6, is a chemical compound that belongs to the class of flavonoids, specifically a derivative of coumarin. This substance features a chromen-7-yl moiety, which is characterized by a fused benzene and pyrone ring structure, contributing to its aromatic properties. The presence of the phenyl group enhances its stability and may influence its biological activity. The propanoic acid functional group indicates that it possesses acidic properties, which can affect its solubility and reactivity in various environments. This compound may exhibit potential pharmacological activities, including antioxidant and anti-inflammatory effects, due to the presence of the chromen-7-yl structure. Its unique combination of functional groups allows for various interactions in biological systems, making it a subject of interest in medicinal chemistry and drug development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.

Formula: C₁₈H₁₄O₅

InChI: InChI=1/C18H14O5/c1-11(18(20)21)23-13-7-8-14-16(9-13)22-10-15(17(14)19)12-5-3-2-4-6-12/h2-11H,1H3,(H,20,21)

SMILES: CC(C(=O)O)Oc1ccc2c(c1)occ(c1ccccc1)c2=O

2-[(4-Oxo-3-phenyl-4H-chromen-7-yl)oxy]propanoic acid

CAS: 99007-90-6

Molecular weight: 310.30499267578125

Ref: 10-F095455