CAS 99010-07-8
:4-Chloro-6-fluoro-3-nitroquinoline
Description:
4-Chloro-6-fluoro-3-nitroquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of chlorine, fluorine, and nitro groups at specific positions on the quinoline ring significantly influences its chemical properties and reactivity. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it useful in various chemical applications. Its nitro group can participate in electrophilic substitution reactions, while the halogen substituents can enhance its reactivity and potential for further functionalization. Additionally, compounds like 4-Chloro-6-fluoro-3-nitroquinoline are of interest in medicinal chemistry due to their potential biological activities, including antimicrobial and antitumor properties. The compound's unique combination of functional groups may also contribute to its utility in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C9H4ClFN2O2
InChI:InChI=1S/C9H4ClFN2O2/c10-9-6-3-5(11)1-2-7(6)12-4-8(9)13(14)15/h1-4H
InChI key:InChIKey=JTKXABQYVUAKJV-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=CC1N(=O)=O)C=CC(F)=C2
Synonyms:- 4-Chloro-6-fluoro-3-nitroquinoline
- Quinoline, 4-chloro-6-fluoro-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
