CAS 99010-24-9
:1-(2-methylpropyl)-1H-imidazo[4,5-c]quinoline
Description:
1-(2-Methylpropyl)-1H-imidazo[4,5-c]quinoline, with the CAS number 99010-24-9, is a heterocyclic organic compound characterized by its imidazoquinoline structure, which incorporates both imidazole and quinoline moieties. This compound typically exhibits a fused ring system, contributing to its unique chemical properties. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may interact with biological targets. The presence of the 2-methylpropyl group can influence its solubility, lipophilicity, and overall biological activity. As a member of the imidazoquinoline family, it may possess interesting pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would need to be referenced for detailed insights. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research focused on developing new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H15N3
InChI:InChI=1/C14H15N3/c1-10(2)8-17-9-16-13-7-15-12-6-4-3-5-11(12)14(13)17/h3-7,9-10H,8H2,1-2H3
SMILES:CC(C)Cn1cnc2cnc3ccccc3c12
Synonyms:- 1H-Imidazo[4,5-c]quinoline, 1-(2-methylpropyl)-
- 1-Isobutyl-1H-imidazo[4,5-c]quinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Imiquimod Related Compound A (1-Isobutyl-1H-imidazo[4,5-c]quinoline)
CAS:Aromatic or modified aromatic heterocyclic compounds withnitrogen hetero-atom(s) only nesoiFormula:C14H15N3Color and Shape:Light Brown PowderMolecular weight:225.291-Isobutyl-1H-imidazo[4,5-c]quinoline
CAS:Formula:C14H15N3Purity:95%Color and Shape:SolidMolecular weight:225.2890Imiquimod USP Related Compound A
CAS:Formula:C14H15N3Color and Shape:Off-White SolidMolecular weight:225.301-Isobutyl-1H-imidazo[4,5-c]quinoline
CAS:<p>1-Isobutyl-1H-imidazo[4,5-c]quinoline</p>Purity:95%Molecular weight:225.3g/molImiquimod USP Related Compound A
CAS:Controlled ProductFormula:C14H15N3Color and Shape:NeatMolecular weight:225.291-Isobutyl-1H-imidazo[4,5-c]quinoline
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:225.2949981689453








