
CAS 99042-97-4
:1,3-Dihydro-5-methyl-2H-pyrrol-2-one
Description:
1,3-Dihydro-5-methyl-2H-pyrrol-2-one, with the CAS number 99042-97-4, is a heterocyclic organic compound characterized by its pyrrolidinone structure. This compound features a five-membered ring containing both nitrogen and a carbonyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a methyl group at the 5-position enhances its hydrophobic properties and may influence its biological activity. Typically, compounds of this class exhibit moderate polarity, making them soluble in organic solvents while having limited solubility in water. 1,3-Dihydro-5-methyl-2H-pyrrol-2-one may serve as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to undergo further chemical transformations. Additionally, its structural features may impart unique properties, such as the potential for forming hydrogen bonds, which can affect its interactions in biological systems. Overall, this compound is of interest in both synthetic chemistry and potential medicinal applications.
Formula:C5H7NO
InChI:InChI=1S/C5H7NO/c1-4-2-3-5(7)6-4/h2H,3H2,1H3,(H,6,7)
InChI key:InChIKey=LFBGIFBGRANTTN-UHFFFAOYSA-N
SMILES:CC=1NC(=O)CC1
Synonyms:- 1,3-Dihydro-5-methyl-2H-pyrrol-2-one
- 2H-Pyrrol-2-one, 1,3-dihydro-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.