CAS 99056-35-6

ethyl 2-methyl-7-oxo-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate

Description:

Ethyl 2-methyl-7-oxo-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate, with the CAS number 99056-35-6, is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. The presence of the 7-oxo group indicates a ketone functionality, which can influence its chemical behavior and potential interactions in various reactions. The ethyl ester moiety enhances its lipophilicity, making it more soluble in organic solvents. This compound may exhibit biological activity, as many derivatives of pyrazolo-pyrimidines are known for their pharmacological properties, including anti-inflammatory and anti-cancer activities. Its molecular structure suggests potential for diverse applications in medicinal chemistry and drug development. As with many heterocycles, the stability and reactivity of this compound can be influenced by substituents on the ring, making it a subject of interest for further research in synthetic and medicinal chemistry.

Formula: C₁₀H₁₁N₃O₃

InChI: InChI=1/C10H11N3O3/c1-3-16-10(15)7-5-11-8-4-6(2)12-13(8)9(7)14/h4-5,11H,3H2,1-2H3

SMILES: CCOC(=O)c1c[nH]c2cc(C)nn2c1=O

Ethyl 2-methyl-7-oxo-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate

CAS: 99056-35-6

Ethyl 2-methyl-7-oxo-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate

Purity: ≥95%

Molecular weight: 221.21g/mol

Ref: 54-OR25189