CAS 99057-84-8

6-Bromo-2,3-dihydro-1-methyl-4(1H)-quinolinone

Description:

6-Bromo-2,3-dihydro-1-methyl-4(1H)-quinolinone is a chemical compound characterized by its quinolinone structure, which features a bromine atom at the 6-position and a methyl group at the 1-position of the quinoline ring. This compound typically exhibits a fused bicyclic structure, contributing to its unique chemical properties. It is known for its potential biological activity, which may include antimicrobial and anti-inflammatory effects, making it of interest in medicinal chemistry. The presence of the bromine substituent can influence its reactivity and solubility, while the dihydro form indicates that it has a saturated bond within the ring system. The compound is generally soluble in organic solvents, and its stability can be affected by environmental conditions such as light and temperature. As with many quinolinone derivatives, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the nitrogen atoms in the ring. Overall, 6-Bromo-2,3-dihydro-1-methyl-4(1H)-quinolinone is a compound of interest in both synthetic and pharmaceutical chemistry.

Formula: C₁₀H₁₀BrNO

InChI: InChI=1S/C10H10BrNO/c1-12-5-4-10(13)8-6-7(11)2-3-9(8)12/h2-3,6H,4-5H2,1H3

InChI key: InChIKey=IIBQTBPBZVNIKV-UHFFFAOYSA-N

SMILES: O=C1C=2C(N(C)CC1)=CC=C(Br)C2

Synonyms:

• 4(1H)-Quinolone, 6-bromo-2,3-dihydro-1-methyl-
• 4(1H)-Quinolinone, 6-bromo-2,3-dihydro-1-methyl-
• 6-Bromo-2,3-dihydro-1-methyl-4(1H)-quinolinone