CAS 99066-76-9

5-phenyl-1,3,4-oxadiazole-2-carboxylic acid

Description:

5-Phenyl-1,3,4-oxadiazole-2-carboxylic acid is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a phenyl group attached to the oxadiazole ring, contributing to its aromatic properties. The carboxylic acid functional group (-COOH) at the 2-position of the oxadiazole ring imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The presence of both the phenyl group and the carboxylic acid enhances its potential for forming hydrogen bonds, which can influence its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its unique structure allows for potential applications in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many heterocycles, the stability and reactivity of 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid can be influenced by substituents and environmental conditions.

Formula: C9H6N2O3

InChI: InChI=1S/C9H6N2O3/c12-9(13)8-11-10-7(14-8)6-4-2-1-3-5-6/h1-5H,(H,12,13)

InChI key: HCTMDIVCEAEJOQ-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=NN=C(O2)C(=O)O

5-Phenyl-1,3,4-oxadiazole-2-carboxylic acid

CAS: 99066-76-9

Formula: C₉H₆N₂O₃

Color and Shape: Solid

Molecular weight: 190.1555

Ref: IN-DA00IK7X