CAS 99066-77-0
:2-oxo-1,2-dihydroquinazoline-4-carboxylic acid
Description:
2-Oxo-1,2-dihydroquinazoline-4-carboxylic acid is a heterocyclic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. This compound features a carbonyl group (oxo) at the 2-position and a carboxylic acid functional group at the 4-position, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmaceutical research, as derivatives of quinazoline are known for their biological activities, including anti-cancer and anti-inflammatory properties. Its molecular structure allows for potential interactions with biological targets, making it a subject of study for drug development. Additionally, the compound may exhibit various reactivity patterns typical of carboxylic acids and carbonyl compounds, which can be exploited in synthetic chemistry. Overall, 2-oxo-1,2-dihydroquinazoline-4-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C9H6N2O3
InChI:InChI=1/C9H6N2O3/c12-8(13)7-5-3-1-2-4-6(5)10-9(14)11-7/h1-4H,(H,12,13)(H,10,11,14)
SMILES:c1ccc2c(c1)c(C(=O)O)nc(n2)O
Synonyms:- 4-Quinazolinecarboxylic acid, 1,2-dihydro-2-oxo-
- 2-oxo-1,2-dihydroquinazolin-4-carboxylic acid
- 2-Oxo-1,2-dihydro-quizoline-4-carboxylic acid
- 2-OXO-1,2-DIHYDRO-QUINAZOLINE-4-CARBOXYLIC ACID
- 2-oxo-1,2-dihydroquinazoline-4-carboxylic acid(SALTDATA: H2O)
- 2-Quinazolone-4-carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Hydroxy-4-quinazolinecarboxylic acid
CAS:2-Hydroxy-4-quinazolinecarboxylic acid is a white, crystalline solid that is soluble in water. It is a carbamate and is used to synthesize guanidine derivatives. 2-Hydroxy-4-quinazolinecarboxylic acid can be obtained by decarboxylation of 2,6-dichloroquinazoline with sodium or potassium hydroxide in water. This condensation product is then methylated with methyl iodide in the presence of potassium hydroxide. The final step involves the addition of an inert solvent such as acetone or ether and the salt potassium chloride to produce 2-hydroxy-4-quinazolinecarboxylic acid.Formula:C9H6N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:190.16 g/mol

