CymitQuimica logo

CAS 99070-17-4

:

3-Bromo-4-(1-methylethyl)benzoic acid

Description:
3-Bromo-4-(1-methylethyl)benzoic acid, with the CAS number 99070-17-4, is an aromatic carboxylic acid characterized by the presence of a bromine atom and an isopropyl group attached to a benzoic acid structure. This compound features a bromine substituent at the meta position (3-position) and an isopropyl group at the para position (4-position) relative to the carboxylic acid functional group. The presence of these substituents influences its physical and chemical properties, such as solubility, boiling point, and reactivity. Generally, compounds like this exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and the isopropyl group. The bromine atom can also impart unique reactivity, making it useful in various synthetic applications, including the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry contexts.
Formula:C10H11BrO2
InChI:InChI=1S/C10H11BrO2/c1-6(2)8-4-3-7(10(12)13)5-9(8)11/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=VLOPEDMMJXCNSH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Br)=C(C(C)C)C=C1
Synonyms:
  • 3-Bromo-4-(1-methylethyl)benzoic acid
  • Benzoic acid, 3-bromo-4-(1-methylethyl)-
  • 3-Bromo-4-(propan-2-yl)benzoic acid
  • Cumic acid, 3-bromo-
  • Benzoic acid, 3-bromo-4-isopropyl-
Found 5 products.