CAS 99070-51-6

(2R)-2-chloro-N-(methylcarbamoyl)-2-phenylethanamide

Description:

(2R)-2-chloro-N-(methylcarbamoyl)-2-phenylethanamide, with the CAS number 99070-51-6, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a chiral center at the second carbon, which is attached to a chlorine atom, a phenyl group, and a methylcarbamoyl moiety. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential hydrogen bonding capabilities due to the presence of the amide functional group. The chlorinated carbon may impart unique reactivity, making it a candidate for various chemical transformations. Additionally, the presence of the phenyl group suggests potential aromatic interactions, which could influence its biological activity and stability. Overall, this compound's structure indicates it may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological or pharmacological properties would require further investigation.

Formula: C₁₀H₁₁ClN₂O₂

InChI: InChI=1/C10H11ClN2O2/c1-12-10(15)13-9(14)8(11)7-5-3-2-4-6-7/h2-6,8H,1H3,(H2,12,13,14,15)/t8-/m1/s1

SMILES: CN=C(N=C([C@@H](c1ccccc1)Cl)O)O

1-(2-Chloro-2-phenylacetyl)-3-methylurea

CAS: 99070-51-6

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 226.66 g/mol

Ref: 3D-ZDA07051