CAS 99072-87-4

3-methyl-4-oxo-3,4-dihydrophthalazine-1-carbohydrazide

Description:

3-Methyl-4-oxo-3,4-dihydrophthalazine-1-carbohydrazide, with the CAS number 99072-87-4, is a chemical compound that belongs to the class of phthalazine derivatives. It features a phthalazine core structure, which is characterized by a fused bicyclic system containing two nitrogen atoms. The presence of a methyl group and a carbonyl group contributes to its unique reactivity and potential biological activity. This compound is typically synthesized through specific organic reactions involving hydrazine derivatives and diketones. It may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during its use in laboratory or industrial settings.

Formula: C₁₀H₁₀N₄O₂

InChI: InChI=1/C10H10N4O2/c1-14-10(16)7-5-3-2-4-6(7)8(13-14)9(15)12-11/h2-5H,11H2,1H3,(H,12,15)

SMILES: Cn1c(=O)c2ccccc2c(C(=O)NN)n1

Synonyms:

• 3-Methyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide

3-Methyl-4-oxo-3,4-dihydrophthalazine-1-carbohydrazide

CAS: 99072-87-4

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₄O₂

Purity: Min. 95%

Molecular weight: 218.21 g/mol

Ref: 3D-ZDA07287