CAS 99083-11-1

(2E,4E)-6-(5-bromonaphthalen-2-yl)-N-(1,2-dimethylpropyl)hexa-2,4-dienamide

Description:

The chemical substance known as (2E,4E)-6-(5-bromonaphthalen-2-yl)-N-(1,2-dimethylpropyl)hexa-2,4-dienamide, with the CAS number 99083-11-1, is characterized by its complex structure, which includes a hexa-2,4-dienamide backbone and a bromonaphthalene moiety. This compound features multiple double bonds, indicating it has unsaturation, which can influence its reactivity and stability. The presence of the bromine atom introduces halogen characteristics, potentially affecting its solubility and biological activity. The N-(1,2-dimethylpropyl) substituent suggests steric hindrance, which may impact the compound's interactions with biological targets. Overall, this substance is likely to exhibit unique chemical properties, including potential applications in medicinal chemistry or materials science, due to its structural features. Its specific reactivity, solubility, and biological activity would require further investigation through experimental studies to fully understand its characteristics and potential uses.

Formula: C₂₁H₂₄BrNO

InChI: InChI=1/C21H24BrNO/c1-15(2)16(3)23-21(24)11-6-4-5-8-17-12-13-19-18(14-17)9-7-10-20(19)22/h4-7,9-16H,8H2,1-3H3,(H,23,24)/b5-4+,11-6+

BTG 502

CAS: 99083-11-1

BTG 502 is an alkylamide insecticide that binds to voltage-gated sodium channels, antagonising the activation of sodium channels by Batrachotoxin (BTX).

Formula: C₂₁H₂₄BrNO

Purity: 99.30%

Color and Shape: Solid

Molecular weight: 386.33

Ref: TM-T23827