CAS 99107-52-5
:Bunaprolast
Description:
Bunaprolast is a chemical compound classified as a selective inhibitor of leukotriene synthesis, primarily used in the treatment of respiratory conditions such as asthma and chronic obstructive pulmonary disease (COPD). It is known for its anti-inflammatory properties, which help in reducing bronchoconstriction and improving airflow in the lungs. The compound has a molecular formula that reflects its complex structure, which includes various functional groups contributing to its pharmacological activity. Bunaprolast operates by inhibiting the enzyme lipoxygenase, thereby decreasing the production of leukotrienes, which are inflammatory mediators involved in bronchial inflammation and constriction. Its therapeutic effects are often evaluated in clinical settings, focusing on its efficacy and safety profile. Additionally, Bunaprolast is characterized by its solubility in organic solvents and relatively low solubility in water, which can influence its formulation and delivery in pharmaceutical applications. As with any medication, potential side effects and contraindications should be considered, and its use should be guided by healthcare professionals.
Formula:C17H20O3
InChI:InChI=1/C17H20O3/c1-4-5-8-13-11-16(19-3)14-9-6-7-10-15(14)17(13)20-12(2)18/h6-7,9-11H,4-5,8H2,1-3H3
SMILES:CCCCc1cc(c2ccccc2c1OC(=O)C)OC
Synonyms:- 1-Naphthalenol, 2-Butyl-4-Methoxy-, Acetate
- 2-Butyl-4-methoxy-1-naphthol acetate
- 99107-52-5
- 2-Butyl-4-Methoxynaphthalen-1-Yl Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bunaprolast
CAS:Bunaprolast is a pharmaceutical compound that serves as a potent phosphodiesterase inhibitor. It is synthetically derived and exhibits its action by selectively inhibiting the breakdown of cyclic nucleotides, such as cyclic AMP (cAMP) and cyclic GMP (cGMP), within the cell. This mechanism effectively elevates the intracellular concentrations of these second messengers, leading to physiological effects such as vasodilation and reduction in inflammatory responses.
Formula:C17H20O3Purity:Min. 95%Molecular weight:272.34 g/molBunaprolast
CAS:Bunaprolast (U66858) is a novel and potent leukotriene B4 (LTB4) inhibitor.Bunaprolast exhibits oxidative degradation activity and inhibits lipoxygenase andFormula:C17H20O3Purity:>99.99%Color and Shape:SolidMolecular weight:272.34


