CAS 99132-29-3

N,5,6-Trimethyl-2-pyridinamine

Description:

N,5,6-Trimethyl-2-pyridinamine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three methyl groups attached to the nitrogen and carbon atoms at the 5 and 6 positions of the pyridine ring, contributing to its unique chemical properties. The presence of the amino group (-NH2) at the 2-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The trimethyl substitution can influence the compound's solubility, boiling point, and overall stability. Additionally, due to the presence of the nitrogen atom, N,5,6-Trimethyl-2-pyridinamine may exhibit basic properties and can participate in hydrogen bonding. This compound may find applications in organic synthesis, pharmaceuticals, or as a ligand in coordination chemistry. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.

Formula: C₈H₁₂N₂

InChI: InChI=1S/C8H12N2/c1-6-4-5-8(9-3)10-7(6)2/h4-5H,1-3H3,(H,9,10)

InChI key: InChIKey=LLLALLARMSBOTR-UHFFFAOYSA-N

SMILES: N(C)C=1N=C(C)C(C)=CC1

Synonyms:

• N,5,6-Trimethyl-2-pyridinamine
• 2-Pyridinamine, N,5,6-trimethyl-
• 2,3-Dimethyl-6-methylaminopyridine