CAS 99134-12-0
:(2S,6S)-3-(3-fluoropropyl)-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol
Description:
The chemical substance known as "(2S,6S)-3-(3-fluoropropyl)-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol" with CAS number 99134-12-0 is a complex organic compound characterized by its unique bicyclic structure, which incorporates a benzazocine framework. This compound features multiple chiral centers, specifically at the 2 and 6 positions, contributing to its stereochemical diversity. The presence of a fluoropropyl group enhances its potential for biological activity, possibly influencing its pharmacological properties. The dimethyl groups at the 6 and 11 positions suggest steric hindrance, which may affect the compound's interaction with biological targets. Additionally, the hexahydro structure indicates that it is a saturated compound, which may contribute to its stability and solubility characteristics. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C17H24FNO
InChI:InChI=1/C17H24FNO/c1-12-16-10-13-4-5-14(20)11-15(13)17(12,2)6-9-19(16)8-3-7-18/h4-5,11-12,16,20H,3,6-10H2,1-2H3/t12?,16-,17-/m0/s1
SMILES:CC1[C@@H]2Cc3ccc(cc3[C@@]1(C)CCN2CCCF)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.