CymitQuimica logo

CAS 99138-92-8

:

N2-(2-Pyridinylmethyl)-2,3-pyridinediamine

Description:
N2-(2-Pyridinylmethyl)-2,3-pyridinediamine, with the CAS number 99138-92-8, is a chemical compound characterized by its complex structure, which includes multiple pyridine rings. This compound typically exhibits properties associated with amines and heterocyclic compounds, such as basicity due to the presence of nitrogen atoms in the pyridine rings. It is often used in various chemical applications, including as a ligand in coordination chemistry, where it can form complexes with metal ions. The presence of multiple functional groups allows for potential reactivity in organic synthesis and medicinal chemistry. Additionally, its solubility can vary depending on the solvent, and it may exhibit specific optical properties due to its structural configuration. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, N2-(2-Pyridinylmethyl)-2,3-pyridinediamine is a versatile compound with applications in research and industry.
Formula:C11H12N4
InChI:InChI=1S/C11H12N4/c12-10-5-3-7-14-11(10)15-8-9-4-1-2-6-13-9/h1-7H,8,12H2,(H,14,15)
InChI key:InChIKey=PQYWRHJKOWSNPL-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=N1)C2=C(N)C=CC=N2
Synonyms:
  • 2-N-(Pyridin-2-ylmethyl)pyridine-2,3-diamine
  • N2-(2-Pyridinylmethyl)-2,3-pyridinediamine
  • 2,3-Pyridinediamine, N2-(2-pyridinylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.