CymitQuimica logo

CAS 99146-53-9

:

3-(methylsulfinyl)-4-nitro-L-phenylalanyl-N-(aminoacetyl)-N-(2-aminobutanoyl)-2-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-L-prolinamide hydrochloride (1:1)

Description:
The chemical substance known as 3-(methylsulfinyl)-4-nitro-L-phenylalanyl-N-(aminoacetyl)-N-(2-aminobutanoyl)-2-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-L-prolinamide hydrochloride (1:1), with the CAS number 99146-53-9, is a complex organic compound characterized by its multi-functional structure. It features a combination of amino acids and functional groups, including a methylsulfinyl group and a nitro group, which contribute to its unique chemical properties. The presence of multiple chiral centers indicates that the compound may exhibit stereoisomerism, potentially influencing its biological activity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability. This compound may be of interest in pharmaceutical research, particularly in the development of therapeutic agents, due to its intricate structure and potential interactions with biological systems. However, specific details regarding its reactivity, stability, and biological effects would require further investigation through empirical studies.
Formula:C30H40ClN7O9S
InChI:InChI=1/C30H39N7O9S.ClH/c1-3-20(32)28(42)36(25(39)16-31)29(43)30(26(40)21(33)13-17-5-8-19(38)9-6-17)11-4-12-35(30)27(41)22(34)14-18-7-10-23(37(44)45)24(15-18)47(2)46;/h5-10,15,20-22,38H,3-4,11-14,16,31-34H2,1-2H3;1H/t20?,21-,22-,30+,47?;/m0./s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.