CAS 99150-60-4
:formadicin
Description:
Formadicin, with the CAS number 99150-60-4, is a chemical compound that belongs to the class of organic compounds known as amides. It is characterized by the presence of a formamide functional group, which consists of a carbonyl group (C=O) directly attached to a nitrogen atom (N). This compound is typically a colorless to pale yellow liquid and is soluble in water and various organic solvents, making it versatile in chemical applications. Formadicin is primarily used in the synthesis of pharmaceuticals and agrochemicals, as well as in research settings for its potential biological activities. Its reactivity is influenced by the presence of the amide bond, which can participate in various chemical reactions, including hydrolysis and condensation. Safety data indicates that, like many amides, it should be handled with care, as it may pose health risks upon exposure. Overall, formadicin is an important compound in organic chemistry with applications in multiple fields.
Formula:C30H34N4O16
InChI:InChI=1/C30H34N4O16/c31-17(25(41)42)9-10-48-15-5-3-14(4-6-15)19(36)24(40)33-30(32-12-35)11-34(29(30)47)18(26(43)44)13-1-7-16(8-2-13)49-28-22(39)20(37)21(38)23(50-28)27(45)46/h1-8,12,17-23,28,36-39H,9-11,31H2,(H,32,35)(H,33,40)(H,41,42)(H,43,44)(H,45,46)
Synonyms:- Antibiotic TAN-585A
- β-D-Glucopyranosiduronic acid, 4-[(R)-[(3S)-3-[[(2R)-[4-[(3R)-3-amino-3-carboxypropoxy]phenyl]hydroxyacetyl]amino]-3-(formylamino)-2-oxo-1-azetidinyl]carboxymethyl]phenyl (9CI)
- 6-[4-[[3-[[2-[4-(3-amino-3-carboxypropoxy)phenyl]-2-hydroxyacetyl]amino]-3-formamido-2-oxoazetidin-1-yl]-carboxymethyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid
- Formadicin A
- (3S,αR)-3-[[(R)-[4-[(R)-3-Amino-3-carboxypropoxy]phenyl]hydroxyacetyl]amino]-3-formylamino-α-[4-[(β-D-glucopyranuronosyl)oxy]phenyl]-2-oxo-1-azetidineacetic acid
- formadicin
- Antibiotic PA-42702B
- TAN-585A
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Formadicin A
CAS:Formadicin A exhibits strong activity against various Pseudomonas, Proteus, and Alcaligenes bacteria.Formula:C30H34N4O16Color and Shape:SolidMolecular weight:706.608
