CymitQuimica logo

CAS 99158-60-8

:

2-(Methylthio)thiazolo[4,5-b]pyridine

Description:
2-(Methylthio)thiazolo[4,5-b]pyridine is a heterocyclic compound characterized by the presence of both thiazole and pyridine rings, which contribute to its unique chemical properties. The thiazole ring contains sulfur and nitrogen atoms, enhancing its reactivity and potential for forming various derivatives. The methylthio group (-S-CH3) attached to the thiazole ring can influence the compound's solubility and polarity, making it more lipophilic. This compound is typically studied for its biological activity, particularly in medicinal chemistry, where it may exhibit antimicrobial, antifungal, or anticancer properties. Its structural features allow for interactions with biological targets, making it a candidate for drug development. Additionally, the compound's stability and reactivity can be influenced by the presence of substituents on the rings, which can affect its synthesis and application in various chemical reactions. Overall, 2-(Methylthio)thiazolo[4,5-b]pyridine represents a class of compounds with significant potential in pharmaceutical research and development.
Formula:C7H6N2S2
InChI:InChI=1S/C7H6N2S2/c1-10-7-9-6-5(11-7)3-2-4-8-6/h2-4H,1H3
InChI key:InChIKey=XNPFLEICSMQHLM-UHFFFAOYSA-N
SMILES:S(C)C1=NC=2C(S1)=CC=CN2
Synonyms:
  • 2-(Methylsulfanyl)-[1,3]thiazolo[4,5-b]pyridine
  • 2-(Methylthio)thiazolo[4,5-b]pyridine
  • Thiazolo[4,5-b]pyridine, 2-(methylthio)-
  • 2-(Methylthio)-[1,3]thiazolo[4,5-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.