CAS 99169-93-4

Ethyl 2-ethyl-4-methyl-5-pyrimidinecarboxylate

Description:

Ethyl 2-ethyl-4-methyl-5-pyrimidinecarboxylate is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The presence of the ethyl and methyl substituents on the pyrimidine ring influences its physical and chemical properties, such as boiling point, melting point, and solubility in various solvents. Ethyl 2-ethyl-4-methyl-5-pyrimidinecarboxylate may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques like NMR and mass spectrometry to confirm its structure and purity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1S/C10H14N2O2/c1-4-9-11-6-8(7(3)12-9)10(13)14-5-2/h6H,4-5H2,1-3H3

InChI key: InChIKey=OZQFDVQNFFHLEV-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(C)=NC(CC)=NC1

Synonyms:

• 2-Ethyl-4-methyl-pyrimidine-5-carboxylic acid ethyl ester
• Ethyl 2-ethyl-4-methyl-5-pyrimidinecarboxylate
• 5-Pyrimidinecarboxylic acid, 2-ethyl-4-methyl-, ethyl ester