
CAS 99171-12-7
:P-(2-Amino-4-pyrimidinyl)phosphonic acid
Description:
P-(2-Amino-4-pyrimidinyl)phosphonic acid, with the CAS number 99171-12-7, is a chemical compound that features a pyrimidine ring substituted with an amino group and a phosphonic acid functional group. This compound is characterized by its ability to act as a phosphonate, which can participate in various biochemical processes, particularly in the context of enzyme inhibition and metabolic pathways. The presence of the amino group enhances its potential for biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific enzymes or pathways. The compound is typically soluble in water due to the phosphonic acid group, which can ionize, contributing to its reactivity and interaction with biological systems. Its structural features suggest potential applications in agriculture, biochemistry, and medicinal chemistry, where it may serve as a lead compound for further modifications to enhance efficacy and selectivity in therapeutic applications.
Formula:C4H6N3O3P
InChI:InChI=1S/C4H6N3O3P/c5-4-6-2-1-3(7-4)11(8,9)10/h1-2H,(H2,5,6,7)(H2,8,9,10)
InChI key:InChIKey=GVDPFALIUBQQIM-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)C1=NC(N)=NC=C1
Synonyms:- P-(2-Amino-4-pyrimidinyl)phosphonic acid
- Phosphonic acid, (2-amino-4-pyrimidinyl)-
- (2-Aminopyrimidin-4-yl)phosphonic acid
- Phosphonic acid, P-(2-amino-4-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.