CAS 99177-74-9

3-[(4-chlorophenyl)methylsulfanyl]propan-1-amine

Description:

3-[(4-Chlorophenyl)methylsulfanyl]propan-1-amine, with the CAS number 99177-74-9, is an organic compound characterized by its amine functional group and a propyl chain. The presence of a 4-chlorophenyl group indicates that it has a chlorine atom substituted on a phenyl ring, which can influence its reactivity and biological activity. The methylsulfanyl group suggests the presence of a sulfur atom bonded to a methyl group, contributing to the compound's overall polarity and potential interactions in biological systems. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components. Additionally, the chlorophenyl moiety may enhance lipophilicity, affecting the compound's pharmacokinetics. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups.

Formula: C₁₀H₁₄ClNS

InChI: InChI=1/C10H14ClNS/c11-10-4-2-9(3-5-10)8-13-7-1-6-12/h2-5H,1,6-8,12H2

SMILES: C(CN)CSCc1ccc(cc1)Cl

3-[(4-chlorobenzyl)thio]-1-propanamine

CAS: 99177-74-9

Formula: C₁₀H₁₄ClNS

Purity: 95.0%

Molecular weight: 215.74

Ref: 10-F311919