CAS 99186-50-2

1-[4-(ethylsulfonyl)phenyl]ethanone

Description:

1-[4-(Ethylsulfonyl)phenyl]ethanone, with the CAS number 99186-50-2, is an organic compound characterized by its structure, which features an ethanone moiety attached to a phenyl group that is further substituted with an ethylsulfonyl group. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly as an intermediate in the production of various pharmaceuticals. The presence of the ethylsulfonyl group enhances its solubility in polar solvents and may influence its reactivity and biological activity. Additionally, the compound may exhibit specific functional properties, such as being a potential electrophile due to the carbonyl group in the ethanone structure. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices. Overall, 1-[4-(ethylsulfonyl)phenyl]ethanone is a notable compound in the realm of organic chemistry.

Formula: C₁₀H₁₂O₃S

InChI: InChI=1/C10H12O3S/c1-3-14(12,13)10-6-4-9(5-7-10)8(2)11/h4-7H,3H2,1-2H3

SMILES: CCS(=O)(=O)c1ccc(cc1)C(=O)C

Synonyms:

• Ethanone, 1-[4-(ethylsulfonyl)phenyl]-

4-Ethylsulfonylacetophenone

CAS: 99186-50-2

Formula: C₁₀H₁₂O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.2655

Ref: IN-DA006PDJ

4'-(Ethylsulphonyl)acetophenone

CAS: 99186-50-2

4'-(Ethylsulphonyl)acetophenone

Purity: 97%

Molecular weight: 212.27g/mol

Ref: 54-OR8170

4-Ethylsulfonylacetophenone

CAS: 99186-50-2

Formula: C₁₀H₁₂O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.26

Ref: 10-F034116

4-Ethylsulfonylacetophenone

CAS: 99186-50-2

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₃S

Purity: Min. 95%

Molecular weight: 212.27 g/mol

Ref: 3D-ZDA18650