CAS 99187-01-6

ethyl 5-[(acetyloxy)methyl]-2-furoate

Description:

Ethyl 5-[(acetyloxy)methyl]-2-furoate, identified by its CAS number 99187-01-6, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the acetyloxy group indicates that it has an acetyl moiety attached to a hydroxymethyl group, enhancing its reactivity and potential applications in organic synthesis. Ethyl 5-[(acetyloxy)methyl]-2-furoate may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, such as esterification or hydrolysis, under appropriate conditions. Additionally, the furan ring can be involved in electrophilic aromatic substitution reactions. Overall, this compound's unique structural features and functional groups make it a valuable subject of study in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₂O₅

InChI: InChI=1/C10H12O5/c1-3-13-10(12)9-5-4-8(15-9)6-14-7(2)11/h4-5H,3,6H2,1-2H3

SMILES: CCOC(=O)c1ccc(COC(=O)C)o1

Synonyms:

• Ethyl 5-[(Acetyloxy)Methyl]Furan-2-Carboxylate

ethyl 5-[(acetyloxy)methyl]-2-furoate

CAS: 99187-01-6

ethyl 5-[(acetyloxy)methyl]-2-furoate

Purity: ≥95%

Molecular weight: 212.20g/mol

Ref: 54-OR29153