CymitQuimica logo

CAS 99190-16-6

:

1-Propanol, 3-(4-aminophenoxy)-

Description:
1-Propanol, 3-(4-aminophenoxy)-, also known by its CAS number 99190-16-6, is an organic compound characterized by its structure, which features a propanol backbone with a 4-aminophenoxy group attached at the third carbon. This compound typically exhibits properties associated with both alcohols and aromatic amines, including moderate solubility in water due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding. The aromatic amine component contributes to its potential reactivity, particularly in electrophilic substitution reactions. Additionally, the presence of the amino group may impart basicity and influence the compound's interaction with acids and other electrophiles. 1-Propanol, 3-(4-aminophenoxy)- may find applications in various fields, including pharmaceuticals and materials science, due to its functional groups that can participate in further chemical transformations. Safety considerations should be taken into account, as with many organic compounds, including potential toxicity and reactivity under certain conditions.
Formula:C9H13NO2
InChI:InChI=1S/C9H13NO2/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5,11H,1,6-7,10H2
InChI key:OHLRTNAZWWQJJT-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1N)OCCCO
Found 5 products.