CAS 99191-71-6

Carbamic chloride, 1,6-hexanediylbis[methyl-

Description:

Carbamic chloride, 1,6-hexanediylbis[methyl-] (CAS 99191-71-6) is a chemical compound characterized by its structure, which features a hexanediyl backbone with carbamic chloride functional groups. This compound is typically classified as an organic intermediate and may be used in various chemical syntheses. Its molecular structure suggests the presence of both amine and chloride functionalities, which can influence its reactivity and interactions with other chemical species. The presence of the carbamic chloride moiety indicates potential applications in the synthesis of other organic compounds, particularly in the production of pharmaceuticals or agrochemicals. Additionally, the compound's physical properties, such as solubility, boiling point, and stability, would be influenced by its molecular weight and the nature of its substituents. Safety data should be consulted for handling and storage, as compounds with chloride functionalities can exhibit toxicity or reactivity under certain conditions. Overall, this compound represents a specialized chemical with potential utility in synthetic organic chemistry.

Formula: C₁₀H₁₈Cl₂N₂O₂

InChI: InChI=1S/C10H18Cl2N2O2/c1-13(9(11)15)7-5-3-4-6-8-14(2)10(12)16/h3-8H2,1-2H3

InChI key: InChIKey=VKMVQHFENMMYDS-UHFFFAOYSA-N

SMILES: C(N(C(Cl)=O)C)CCCCCN(C(Cl)=O)C

Synonyms:

• Carbamoyl chloride, hexamethylenebis[methyl-
• Carbamic chloride, 1,6-hexanediylbis[methyl-