CymitQuimica logo

CAS 99196-57-3

:

2-Propenoic acid, 3-[4-(octyloxy)phenyl]-, methyl ester, (2E)-

Description:
2-Propenoic acid, 3-[4-(octyloxy)phenyl]-, methyl ester, commonly referred to as a methacrylate derivative, is an organic compound characterized by its acrylate functional group. This substance features a propenoic acid backbone with a methyl ester group, which enhances its reactivity and solubility in organic solvents. The presence of the octyloxyphenyl substituent contributes to its hydrophobic properties, making it suitable for applications in coatings, adhesives, and polymers. The compound exhibits typical characteristics of methacrylates, such as the ability to undergo free radical polymerization, which is essential for forming cross-linked networks in various materials. Additionally, it may possess moderate to low toxicity, necessitating appropriate handling precautions. Its structural features suggest potential applications in the development of specialty polymers and materials with tailored properties, particularly in the fields of materials science and organic chemistry. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and light exposure.
Formula:C18H26O3
InChI:InChI=1S/C18H26O3/c1-3-4-5-6-7-8-15-21-17-12-9-16(10-13-17)11-14-18(19)20-2/h9-14H,3-8,15H2,1-2H3/b14-11+
InChI key:WICDVRPXTPVVCE-SDNWHVSQSA-N
SMILES:CCCCCCCCOC1=CC=C(C=C1)/C=C/C(=O)OC
Found 0 products.