CAS 99196-74-4

2-[[(2E)-1-Oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]benzoic acid

Description:

2-[[(2E)-1-Oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]benzoic acid, with the CAS number 99196-74-4, is an organic compound characterized by its complex structure that includes both an amino group and a carboxylic acid functional group. This compound features a conjugated system due to the presence of a propenyl moiety, which contributes to its potential reactivity and interaction with other molecules. The pentylphenyl substituent enhances its hydrophobic characteristics, suggesting that it may exhibit significant solubility in organic solvents while being less soluble in water. The presence of the benzoic acid moiety indicates potential for hydrogen bonding and acid-base interactions, which could influence its behavior in biological systems or chemical reactions. Additionally, the compound may exhibit interesting optical properties due to its conjugated double bonds, making it a candidate for applications in materials science or pharmaceuticals. Overall, its unique structure suggests a range of potential applications, particularly in fields that explore organic synthesis and drug development.

Formula: C₂₁H₂₃NO₃

InChI: InChI=1S/C21H23NO3/c1-2-3-4-7-16-10-12-17(13-11-16)14-15-20(23)22-19-9-6-5-8-18(19)21(24)25/h5-6,8-15H,2-4,7H2,1H3,(H,22,23)(H,24,25)/b15-14+

InChI key: InChIKey=GAMRBCZMOOMBSQ-CCEZHUSRSA-N

SMILES: N(C(/C=C/C1=CC=C(CCCCC)C=C1)=O)C2=C(C(O)=O)C=CC=C2

Synonyms:

• BML 264
• Benzoic acid, 2-[[1-oxo-3-(4-pentylphenyl)-2-propenyl]amino]-, (E)-
• Benzoic acid, 2-[[(2E)-1-oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]-
• 2-[[(2E)-1-Oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]benzoic acid
• Benzoic acid, 2-[[(2E)-1-oxo-3-(4-pentylphenyl)-2-propenyl]amino]-

N-(p-Amylcinnamoyl)anthranilic acid

CAS: 99196-74-4

Formula: C₂₁H₂₃NO₃

Molecular weight: 337.41

Ref: 7W-GL5818