CAS 99199-60-7: 6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid
Description:6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a benzopyran moiety. This compound features a fluorine atom at the 6-position and a carboxylic acid functional group at the 2-position, contributing to its reactivity and potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties. The dihydrobenzopyran structure suggests that it may exhibit interesting interactions with biological targets, making it a candidate for research in medicinal chemistry. Additionally, the carboxylic acid group can participate in hydrogen bonding and ionic interactions, which may be relevant in drug design and development. Its CAS number, 99199-60-7, allows for easy identification in chemical databases. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents.
Formula:C10H9FO3
InChI:InChI=1S/C10H9FO3/c11-7-2-4-8-6(5-7)1-3-9(14-8)10(12)13/h2,4-5,9H,1,3H2,(H,12,13)
InChI key:InChIKey=ZNJANLXCXMVFFI-UHFFFAOYSA-N
SMILES:O=C(O)C1OC2=CC=C(F)C=C2CC1
- Synonyms:
- 2H-1-Benzopyran-2-carboxylic acid, 6-fluoro-3,4-dihydro-
- 6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid
- 6-Fluoro-3,4-dihydro-2H-benzopyran-2-carboxylic acid
- 6-Fluorochroman-2-carboxylic acid
- 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid
