CAS 99199-61-8
:2H-1-Benzopyran-2-carboxylic acid, 6-fluoro-3,4-dihydro-, ethyl ester
Description:
2H-1-Benzopyran-2-carboxylic acid, 6-fluoro-3,4-dihydro-, ethyl ester, commonly referred to in the context of its chemical structure, is a compound that belongs to the class of flavonoids, which are known for their diverse biological activities. This substance features a benzopyran core, characterized by a fused benzene and pyran ring, with a carboxylic acid functional group and an ethyl ester moiety. The presence of a fluorine atom at the 6-position contributes to its unique chemical properties, potentially influencing its reactivity and biological interactions. The compound may exhibit various pharmacological effects, including anti-inflammatory, antioxidant, and antimicrobial activities, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can be influenced by the esterification and fluorination, which may also affect its bioavailability and therapeutic efficacy. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C12H13FO3
InChI:InChI=1S/C12H13FO3/c1-2-15-12(14)11-5-3-8-7-9(13)4-6-10(8)16-11/h4,6-7,11H,2-3,5H2,1H3
InChI key:InChIKey=XLTYRVHHKJREDL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1OC=2C(CC1)=CC(F)=CC2
Synonyms:- Ethyl 6-fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylate
- Ethyl 6-fluorochroman-2-carboxylate
- 2H-1-Benzopyran-2-carboxylic acid, 6-fluoro-3,4-dihydro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rac-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic Acid Ethyl Ester
CAS:Controlled ProductApplications Intermediate in the production of Nebivolol
Formula:C12H13FO3Color and Shape:NeatMolecular weight:224.23
