CAS 99199-91-4
:6-Fluoro-3,4-dihydro-α-[[(phenylmethyl)amino]methyl]-2H-1-benzopyran-2-methanol
Description:
6-Fluoro-3,4-dihydro-α-[[(phenylmethyl)amino]methyl]-2H-1-benzopyran-2-methanol, with the CAS number 99199-91-4, is a chemical compound that belongs to the class of benzopyrans, which are characterized by a fused benzene and pyran ring structure. This particular compound features a fluorine atom at the 6-position, which can influence its biological activity and lipophilicity. The presence of the phenylmethylamino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The methanol moiety indicates the presence of a hydroxyl group, which can enhance solubility and reactivity. The compound's structure may confer specific pharmacological properties, potentially including effects on neurotransmitter systems or other biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a research tool in biochemistry.
Formula:C18H20FNO2
InChI:InChI=1S/C18H20FNO2/c19-15-7-9-17-14(10-15)6-8-18(22-17)16(21)12-20-11-13-4-2-1-3-5-13/h1-5,7,9-10,16,18,20-21H,6,8,11-12H2
InChI key:InChIKey=UWHPUMRASBVSQY-UHFFFAOYSA-N
SMILES:C(CNCC1=CC=CC=C1)(O)C2OC=3C(CC2)=CC(F)=CC3
Synonyms:- 2H-1-Benzopyran-2-methanol, 6-fluoro-3,4-dihydro-α-[[(phenylmethyl)amino]methyl]-
- 6-Fluoro-3,4-dihydro-α-[[(phenylmethyl)amino]methyl]-2H-1-benzopyran-2-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

