CAS 992-42-7
:[3-(hexadecanoyloxy)-5-(hydroxymethyl)-2-methylpyridin-4-yl]methyl hexadecanoate
Description:
The chemical substance known as [3-(hexadecanoyloxy)-5-(hydroxymethyl)-2-methylpyridin-4-yl]methyl hexadecanoate, with the CAS number 992-42-7, is a complex organic compound characterized by its pyridine ring structure, which is substituted with various functional groups. This compound features a hexadecanoyloxy group, indicating the presence of a long-chain fatty acid moiety, which contributes to its hydrophobic properties. The hydroxymethyl group adds a polar character, potentially enhancing solubility in certain solvents. The methyl substitution on the pyridine ring may influence its electronic properties and reactivity. Overall, this compound is likely to exhibit amphiphilic characteristics due to the combination of hydrophobic and hydrophilic segments, making it of interest in applications such as drug delivery systems, surfactants, or as a biochemical probe. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C40H71NO5
InChI:InChI=1/C40H71NO5/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-38(43)45-34-37-36(33-42)32-41-35(3)40(37)46-39(44)31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h32,42H,4-31,33-34H2,1-3H3
SMILES:CCCCCCCCCCCCCCCC(=O)OCc1c(cnc(C)c1OC(=O)CCCCCCCCCCCCCCC)CO
Synonyms:- 5-(Hydroxymethyl)-2-methyl-4-[(palmitoyloxy)methyl]pyridin-3-yl palmitate
- Hexadecanoic Acid, 5-(Hydroxymethyl)-2-Methyl-4-[[(1-Oxohexadecyl)Oxy]Methyl]-3-Pyridinyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
