CAS 992-67-6

Crotonyl-CoA

Description:

Crotonyl-CoA, with the CAS number 992-67-6, is a thioester compound that plays a significant role in metabolic pathways, particularly in the metabolism of fatty acids and amino acids. It is an acyl-CoA derivative of crotonic acid and is involved in the synthesis and degradation of various biomolecules. Crotonyl-CoA is characterized by its reactive carbonyl group, which makes it a key intermediate in biochemical reactions, including those catalyzed by enzymes such as crotonase. This compound is typically found in the mitochondria and is crucial for energy production and the synthesis of certain lipids. Its structure includes a coenzyme A moiety, which facilitates its participation in enzymatic reactions. Crotonyl-CoA is also relevant in the context of metabolic disorders, where its accumulation or deficiency can impact cellular energy homeostasis. Overall, Crotonyl-CoA is an essential metabolite in cellular metabolism, contributing to various biochemical pathways that sustain life.

Formula: C₂₅H₄₀N₇O₁₇P₃S

InChI: InChI=1S/C25H40N7O17P3S/c1-4-5-16(34)53-9-8-27-15(33)6-7-28-23(37)20(36)25(2,3)11-46-52(43,44)49-51(41,42)45-10-14-19(48-50(38,39)40)18(35)24(47-14)32-13-31-17-21(26)29-12-30-22(17)32/h4-5,12-14,18-20,24,35-36H,6-11H2,1-3H3,(H,27,33)(H,28,37)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t14-,18-,19-,20+,24-/m1/s1

InChI key: InChIKey=KFWWCMJSYSSPSK-CITAKDKDSA-N

SMILES: O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](COP(OP(OCC([C@H](C(NCCC(NCCSC(C=CC)=O)=O)=O)O)(C)C)(=O)O)(=O)O)[C@H]1OP(=O)(O)O

Synonyms:

• Coenzyme A, S-crotonate
• Crotonyl coenzyme A
• Crotonoyl-CoA
• Crotonyl-CoA
• Coenzyme A, S-2-butenoate

crotonyl-coenzyme A

CAS: 992-67-6

Formula: C₂₅H₄₀N₇O₁₇P₃S

Molecular weight: 835.6081

Ref: IN-DA006ONL

Crotonyl-CoA

CAS: 992-67-6

Crotonyl-CoA: key in butyric acid fermentation, lysine and tryptophan metabolism, crucial for fatty and amino acid processing.

Formula: C₂₅H₄₀N₇O₁₇P₃S

Color and Shape: Solid

Molecular weight: 835.61

Ref: TM-T74171

Crotonyl Coenzyme A

CAS: 992-67-6

Formula: C₂₅H₄₀N₇O₁₇P₃S

Molecular weight: 835.61

Ref: 4Z-C-7127

Crotonyl coenzyme A

CAS: 992-67-6

Involved in the metabolism of fatty acids and amino acids

Formula: C₂₅H₄₀N₇O₁₇P₃S

Purity: Min. 95%

Molecular weight: 835.6 g/mol

Ref: 3D-AAA99267