CymitQuimica logo

CAS 99206-38-9

:

2-(1H-benzimidazol-2-yl)-N-methyl-ethanamine

Description:
2-(1H-benzimidazol-2-yl)-N-methyl-ethanamine, with the CAS number 99206-38-9, is a chemical compound characterized by its unique structure that includes a benzimidazole moiety and a methylated ethylamine group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as moderate solubility in polar solvents and potential basicity due to the presence of the amine functional group. The benzimidazole ring contributes to its stability and may impart biological activity, making it of interest in pharmaceutical research. The compound may also exhibit fluorescence properties, which can be useful in various analytical applications. Its molecular interactions can be influenced by the presence of the nitrogen atoms in the benzimidazole and amine groups, allowing for potential hydrogen bonding and coordination with metal ions. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and materials science, although specific applications would depend on further research and exploration of its properties.
Formula:C10H13N3
InChI:InChI=1/C10H13N3/c1-11-7-6-10-12-8-4-2-3-5-9(8)13-10/h2-5,11H,6-7H2,1H3,(H,12,13)
SMILES:CNCCc1nc2ccccc2[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.