
CAS 99207-33-7
:N1,N4-Di-2,3-butadien-1-yl-1,4-butanediamine
Description:
N1,N4-Di-2,3-butadien-1-yl-1,4-butanediamine, identified by its CAS number 99207-33-7, is an organic compound characterized by its unique structure that includes two butadienyl groups attached to a butanediamine backbone. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It exhibits properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and solubility in various solvents. The presence of the butadienyl groups suggests potential for polymerization and other reactions, making it of interest in materials science and organic synthesis. Additionally, due to its amine functionality, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, this compound's unique structure and reactivity profile make it a subject of interest in both academic and industrial chemistry contexts.
Formula:C12H20N2
InChI:InChI=1S/C12H20N2/c1-3-5-9-13-11-7-8-12-14-10-6-4-2/h5-6,13-14H,1-2,7-12H2
InChI key:InChIKey=IKSQCMLJDHRWOA-UHFFFAOYSA-N
SMILES:C(CCNCC=C=C)CNCC=C=C
Synonyms:- 1,4-Butanediamine N1,N4-di-2,3-butadien-1-yl-
- 1,4-Butanediamine, N1,N4-di-2,3-butadien-1-yl-
- 1,4-Butanediamine, N,N′-di-2,3-butadienyl-
- N1,N4-Bis(2,3-butadienyl)-1,4-butanediamine
- N1,N4-Di-2,3-butadien-1-yl-1,4-butanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
MDL-72527 free base
CAS:MDL-72527 free base is a polyamine oxidase inactivator.Formula:C12H20N2Color and Shape:SolidMolecular weight:192.3

