CAS 99210-65-8
:Interferon Alfa-2b
Description:
Interferon Alfa-2b is a recombinant protein that belongs to the class of interferons, which are cytokines with antiviral, antiproliferative, and immunomodulatory properties. It is produced using recombinant DNA technology and is primarily derived from E. coli. This substance is characterized by its ability to enhance the immune response against viral infections and certain types of cancer. Interferon Alfa-2b is commonly used in the treatment of conditions such as chronic hepatitis C, certain leukemias, and melanoma. Its mechanism of action involves binding to specific receptors on cell surfaces, leading to the activation of various signaling pathways that promote the expression of genes involved in antiviral defense and immune regulation. The substance is typically administered via injection and can have side effects, including flu-like symptoms, fatigue, and changes in mood. Due to its biological nature, the stability and efficacy of Interferon Alfa-2b can be influenced by factors such as temperature and pH, necessitating careful handling and storage.
Formula:C16H17Cl3I2N3NaO5S
InChI:InChI=1/C15H16Cl3N3O2.CH2I2O3S.Na/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18;2-1(3)7(4,5)6;/h3,5,8-10H,2,4,6-7H2,1H3;1H,(H,4,5,6);/q;;+1/p-1
SMILES:CCCN(CCOc1c(cc(cc1Cl)Cl)Cl)C(=O)n1ccnc1.C(I)(I)S(=O)(=O)O.[Na]
Synonyms:- Recombinant human interferon a-2B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

