CAS 99216-67-8
:tert-butyl N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)propyl]carbamate
Description:
Tert-butyl N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)propyl]carbamate, identified by its CAS number 99216-67-8, is a chemical compound that belongs to the class of carbamates. This substance features a tert-butyl group, which contributes to its hydrophobic characteristics, and a carbamate functional group, which is known for its reactivity and ability to form hydrogen bonds. The presence of the hydroxy groups in its structure enhances its solubility in polar solvents and may influence its biological activity. The stereochemistry indicated by the (1R,2R) configuration suggests specific spatial arrangements that can affect the compound's interactions with biological systems, potentially impacting its pharmacological properties. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could be relevant for designing therapeutics or studying enzyme interactions. As with many organic compounds, its stability, reactivity, and potential applications would depend on various factors, including environmental conditions and the presence of other chemical species.
Formula:C9H19NO4
InChI:InChI=1/C9H19NO4/c1-6(12)7(5-11)10-8(13)14-9(2,3)4/h6-7,11-12H,5H2,1-4H3,(H,10,13)/t6-,7-/m1/s1
SMILES:C[C@H]([C@@H](CO)N=C(O)OC(C)(C)C)O
Synonyms:- tert-Butyl [(2R,3R)-1,3-dihydroxybutan-2-yl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
