CAS 99217-64-8

Kushenol B

Description:

Kushenol B is a natural compound classified as a flavonoid, specifically a type of chalcone, derived from the roots of the traditional Chinese medicinal plant Sophora flavescens. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The molecular structure of Kushenol B features a characteristic chalcone backbone, which contributes to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its ability to modulate various signaling pathways and its potential therapeutic applications. Additionally, Kushenol B may exhibit effects on cellular processes such as apoptosis and proliferation, making it a subject of research in cancer therapy. Its solubility and stability in different solvents can vary, influencing its bioavailability and efficacy in biological systems. As with many natural products, further studies are necessary to fully elucidate its mechanisms of action and potential clinical applications.

Formula: C₃₀H₃₆O₆

InChI: InChI=1S/C30H36O6/c1-16(2)7-9-19(18(5)6)13-23-28(34)22(11-8-17(3)4)29(35)27-25(33)15-26(36-30(23)27)21-12-10-20(31)14-24(21)32/h7-8,10,12,14,19,26,31-32,34-35H,5,9,11,13,15H2,1-4,6H3/t19-,26+/m1/s1

InChI key: InChIKey=CDNAGJNJVFLMRS-BCHFMIIMSA-N

SMILES: C([C@@H](CC=C(C)C)C(C)=C)C1=C2C(=C(O)C(CC=C(C)C)=C1O)C(=O)C[C@H](O2)C3=C(O)C=C(O)C=C3

Synonyms:

• (2S)-2-(2,4-Dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-6-(3-methyl-2-buten-1-yl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-6-(3-methyl-2-buten-1-yl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-, (2S)-
• 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-6-(3-methyl-2-butenyl)-8-[5-methyl-2-(1-methylethenyl)-4-hexenyl]-, [S-(R*,S*)]-
• (-)-Kushenol B
• 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-6-(3-methyl-2-butenyl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-, (2S)-
• (2S)-2-(2,4-Dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-6-(3-methyl-2-butenyl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-4H-1-benzopyran-4-one

4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-6-(3-methyl-2-buten-1-yl)-8-[(2R)-5-methyl-2-(1-methylethenyl)-4-hexen-1-yl]-, (2S)-

CAS: 99217-64-8

Formula: C₃₀H₃₆O₆

Purity: 96.0%

Molecular weight: 492.6032

Ref: IN-DA01SQWT

Kushenol B

CAS: 99217-64-8

Kushenol B is a natural product for research related to life sciences. The catalog number is TN4398 and the CAS number is 99217-64-8.

Formula: C₃₀H₃₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 492.6

Ref: TM-TN4398

Kushenol B

CAS: 99217-64-8

Kushenol B is a ligand that activates the G protein-coupled receptor. Kushenol B has been shown to have activity in cell biology, pharmacology and life science research. Kushenol B is a high-purity compound that can be used as an inhibitor in the study of protein interactions with other proteins and peptides. Kushenol B also has been shown to inhibit ion channels, which may lead to potential therapeutic applications for epilepsy and other disorders.

Formula: C₃₀H₃₆O₆

Purity: Min. 95%

Molecular weight: 492.6 g/mol

Ref: 3D-ZDA21764