CAS 99217-67-1

7,10,11-trihydroxy-13-methoxy-7,8-dihydro-3H,6H-7,12b-methanodibenzo[b,d]oxocin-3-one

Description:

7,10,11-trihydroxy-13-methoxy-7,8-dihydro-3H,6H-7,12b-methanodibenzo[b,d]oxocin-3-one, with the CAS number 99217-67-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates both oxocin and dibenzo moieties. This compound features multiple hydroxyl groups, which contribute to its potential solubility in polar solvents and may influence its biological activity. The methoxy group enhances its lipophilicity, potentially affecting its interaction with biological membranes. The presence of multiple functional groups suggests that it may exhibit various chemical reactivities, including hydrogen bonding and potential interactions with enzymes or receptors. Such structural characteristics often indicate potential pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stereochemistry and spatial arrangement of substituents can significantly influence its biological activity and efficacy. Overall, this compound exemplifies the complexity and diversity of organic molecules in the realm of chemical research.

Formula: C₁₇H₁₆O₆

InChI: InChI=1/C17H16O6/c1-22-15-16(21)7-9-4-12(19)13(20)6-11(9)17(15)3-2-10(18)5-14(17)23-8-16/h2-6,15,19-21H,7-8H2,1H3

SMILES: COC1C2(Cc3cc(c(cc3C31C=CC(=O)C=C3OC2)O)O)O

Caesalpin J

CAS: 99217-67-1

Caesalpin J is a natural product for research related to life sciences. The catalog number is TMA2282 and the CAS number is 99217-67-1.

Formula: C₁₇H₁₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 316.309

Ref: TM-TMA2282